
1074-24-4
| Name | 1,4-Dibromo-2,5-dimethylbenzene |
| CAS | 1074-24-4 |
| EINECS(EC#) | 214-038-2 |
| Molecular Formula | C8H8Br2 |
| MDL Number | MFCD00000091 |
| Molecular Weight | 263.96 |
| MOL File | 1074-24-4.mol |
Chemical Properties
| Appearance | white to slightly yellow shiny crystalline powder |
| Melting point | 72-74 °C(lit.) |
| Boiling point | 261 °C(lit.) |
| density | 1.7485 (rough estimate) |
| refractive index | 1.543-1.545 |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Light yellow |
| Water Solubility | Soluble in toluene, hot ethanol and hot methanol.Insoluble in water. |
| BRN | 2080433 |
| InChI | InChI=1S/C8H8Br2/c1-5-3-8(10)6(2)4-7(5)9/h3-4H,1-2H3 |
| InChIKey | QENIALCDPFDFHX-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(C)=C(Br)C=C1C |
| CAS DataBase Reference | 1074-24-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1,4-dibromo-2,5-dimethyl-(1074-24-4) |
| EPA Substance Registry System | Benzene, 1,4-dibromo-2,5-dimethyl- (1074-24-4) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 1 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29039990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |