105931-73-5
| Name | 1-BROMO-3-FLUORO-4-IODOBENZENE |
| CAS | 105931-73-5 |
| EINECS(EC#) | 629-334-0 |
| Molecular Formula | C6H3BrFI |
| MDL Number | MFCD00010608 |
| Molecular Weight | 300.89 |
| MOL File | 105931-73-5.mol |
Chemical Properties
| Appearance | Clear colourless to light yellow liquid |
| Melting point | 48-51 °C (lit.) |
| Boiling point | 243.9±20.0 °C(Predicted) |
| density | 2.2691 (estimate) |
| Fp | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Crystalline Powder, Crystals, and/or Chunks |
| color | Off-white to beige |
| Sensitive | Light Sensitive |
| BRN | 4740250 |
| InChI | InChI=1S/C6H3BrFI/c7-4-1-2-6(9)5(8)3-4/h1-3H |
| InChIKey | XRMZKCQCINEBEI-UHFFFAOYSA-N |
| SMILES | C1(I)=CC=C(Br)C=C1F |
| CAS DataBase Reference | 105931-73-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| REACH Registrations | Active |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |