
105640-07-1
| Name | 4-(4-Hydroxyphenyl)cyclohexanone |
| CAS | 105640-07-1 |
| EINECS(EC#) | 423-920-8 |
| Molecular Formula | C12H14O2 |
| MDL Number | MFCD00210693 |
| Molecular Weight | 190.24 |
| MOL File | 105640-07-1.mol |
Chemical Properties
| Melting point | 170-175 °C |
| Boiling point | 357.2±42.0 °C(Predicted) |
| density | 1.149±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 10.10±0.30(Predicted) |
| color | White to Almost white |
| BRN | 3269332 |
| InChI | InChI=1S/C12H14O2/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-2,5-6,10,13H,3-4,7-8H2 |
| InChIKey | SLJYPZJZQIHNGU-UHFFFAOYSA-N |
| SMILES | C1(=O)CCC(C2=CC=C(O)C=C2)CC1 |
| CAS DataBase Reference | 105640-07-1(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| REACH Registrations | Inactive |
| HS Code | 29145090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
