
102-96-5
| Name | TRANS-BETA-NITROSTYRENE |
| CAS | 102-96-5 |
| EINECS(EC#) | 203-066-0 |
| Molecular Formula | C8H7NO2 |
| MDL Number | MFCD00007402 |
| Molecular Weight | 149.15 |
| MOL File | 102-96-5.mol |
Chemical Properties
| Appearance | yellow crystals |
| Melting point | 55-58 °C(lit.) |
| Boiling point | 250-260 °C(lit.) |
| density | 1.2517 (rough estimate) |
| refractive index | 1.5320 (estimate) |
| storage temp. | 2-8°C |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, strong bases. May be sensitive to prolonged exposure to air. |
| Henry's Law Constant | 2.8×100 mol/(m3Pa) at 25℃, HSDB (2015) |
| InChI | 1S/C8H7NO2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H/b7-6+ |
| InChIKey | PIAOLBVUVDXHHL-VOTSOKGWSA-N |
| SMILES | [N+](=O)([O-])\C=C\c1ccccc1 |
| CAS DataBase Reference | 102-96-5(CAS DataBase Reference) |
| EPA Substance Registry System | .beta.-Nitrostyrene (102-96-5) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | WL5460000 |
| Autoignition Temperature | 250°C |
| TSCA | TSCA listed |
| Storage Class | 6.1A - Combustible, acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 102-96-5(Hazardous Substances Data) |
| Toxicity |