100-31-2
| Name | 4,4'-Stilbenedicarboxylic acid |
| CAS | 100-31-2 |
| EINECS(EC#) | 202-838-4 |
| Molecular Formula | C16H12O4 |
| MDL Number | MFCD00013994 |
| Molecular Weight | 268.26 |
| MOL File | 100-31-2.mol |
Chemical Properties
| Melting point | >300°C |
| Boiling point | 518.5±39.0 °C(Predicted) |
| density | 1.356±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 3.96±0.10(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C16H12O4/c17-15(18)13-7-3-11(4-8-13)1-2-12-5-9-14(10-6-12)16(19)20/h1-10H,(H,17,18)(H,19,20) |
| InChIKey | SBBQDUFLZGOASY-OWOJBTEDSA-N |
| SMILES | C(C1=CC=C(C=C1)C(O)=O)=CC1=CC=C(C=C1)C(O)=O |
| CAS DataBase Reference | 100-31-2(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 2917.39.7000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |