| Melting point |
68-70 °C(lit.) |
| Boiling point |
436.98°C (rough estimate) |
| Density |
1.2393 (rough estimate) |
| refractive index |
1.4365 |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form |
powder to crystal |
| pka |
4.48±0.10(Predicted) |
| color |
White to Almost white |
| optical activity |
[α]20/D 24.0±1°, c = 1% in ethanol |
| BRN |
2567599 |
| Major Application |
peptide synthesis |
| InChI |
1S/C14H17NO6/c1-20-13(18)11(7-8-12(16)17)15-14(19)21-9-10-5-3-2-4-6-10/h2-6,11H,7-9H2,1H3,(H,15,19)(H,16,17)/t11-/m0/s1 |
| InChIKey |
BGMCTGARFXPQML-NSHDSACASA-N |
| SMILES |
COC(=O)[C@H](CCC(O)=O)NC(=O)OCc1ccccc1 |
| CAS DataBase Reference |
5672-83-3 |
