| alpha |
D26 +8° (chloroform) |
| Boiling point |
bp1.2 270-280° |
| Density |
1.19±0.1 g/cm3(Predicted) |
| storage temp. |
Sealed in dry,Store in freezer, under -20°C |
| solubility |
Practically insoluble in water, very soluble in acetone, in methanol and in methylene chloride. |
| pka |
13.01±0.70(Predicted) |
| color |
Pale Yellow to Light Yellow |
| Major Application |
pharmaceutical (small molecule) |
| InChIKey |
ULLNJSBQMBKOJH-VIVFLBMVSA-N |
| SMILES |
O(CC)C1O[C@H]([C@@H](COCC2=CC=CC=C2)OCC2=CC=CC=C2)[C@H](OCC2=CC=CC=C2)[C@H]1O |
| CAS DataBase Reference |
10310-32-4 |
