| Melting point |
221-224 °C (dec.) (lit.) |
| Boiling point |
539.4°C (rough estimate) |
| Density |
1.1413 (rough estimate) |
| bulk density |
350kg/m3 |
| refractive index |
1.5300 (estimate) |
| Flash point |
36 °C |
| storage temp. |
room temp |
| solubility |
0.11g/l |
| form |
Solid |
| pka |
Pka1:1.65(at 25℃)(PH=1.2 to 2.8) Pka2:8.9(at 25℃)(PH=8.0 to 9.6) |
| color |
Dark green to dark brown |
| PH Range |
1.2(red)-2.8(yellow) 8(yellow)-9.6(blue) |
| Odor |
Characteristic odour |
| PH |
1.2-2.8 8.0-9.6 |
| Water Solubility |
Soluble in alcohol and dilute alkali solutions. Insoluble in water. |
| ε(extinction coefficient) |
≥12000 at 298-302nm in 0.1 M NaOH at 0.01g/L |
| λmax |
594nm, 376nm, 544nm, 430nm |
| Merck |
14,9400 |
| BRN |
368036 |
| Stability |
Stable. Combustible. Dust may form an explosive mixture with air. Incompatible with strong oxidizing agents. |
| Major Application |
Display device, semiconductors, sensors, fuel cells, antimisting coating for glass, toys, corrosion inhibitor, multi-level alert system, correction fluid, textiles, falsification-proof security paper, packaging system, measurement of hydrogen ion concentrationin swimming pool water, humidity-indicating agent, diapers, cosmetics, biostatic materials, determine bacteria growth, psychoactive drugs, antidepressant drugs, dental impression material |
| InChI |
1S/C27H30O5S/c1-15(2)19-13-22(17(5)11-24(19)28)27(21-9-7-8-10-26(21)33(30,31)32-27)23-14-20(16(3)4)25(29)12-18(23)6/h7-16,28-29H,1-6H3 |
| InChIKey |
PRZSXZWFJHEZBJ-UHFFFAOYSA-N |
| SMILES |
CC(C)c1cc(c(C)cc1O)C(=C2\C=C(C(C)C)C(=O)C=C2C)\c3ccccc3S(O)(=O)=O |
| CAS DataBase Reference |
76-61-9(CAS DataBase Reference) |
| NIST Chemistry Reference |
Thymolsulfonephthalein(76-61-9) |
| EPA Substance Registry System |
Phenol, 4,4'-(1,1-dioxido-3H-2,1-benzoxathiol-3-ylidene)bis[5-methyl-2-(1-methylethyl)- (76-61-9) |