| Melting point |
191-193°C |
| Boiling point |
473.5±51.0 °C(Predicted) |
| Density |
1.3220 (rough estimate) |
| refractive index |
1.6740 (estimate) |
| storage temp. |
Keep in dark place,Sealed in dry,Room Temperature |
| solubility |
DMSO (Slightly), Methanol (Slightly) |
| form |
Solid |
| pka |
pKa 8.48(H2O
t = 25
I = 0.05) (Uncertain) |
| color |
White to Off-White |
| Water Solubility |
<0.1 g/100 mL at 22 ºC |
| Merck |
14,8938 |
| BRN |
222065 |
| Stability |
Stable. Combustible. Protect from light. Incompatible with strong oxidizing agents. |
| Major Application |
forensics and toxicology
pharmaceutical (small molecule) |
| InChI |
1S/C11H11N3O2S/c12-9-4-6-10(7-5-9)17(15,16)14-11-3-1-2-8-13-11/h1-8H,12H2,(H,13,14) |
| InChIKey |
GECHUMIMRBOMGK-UHFFFAOYSA-N |
| SMILES |
Nc1ccc(cc1)S(=O)(=O)Nc2ccccn2 |
| CAS DataBase Reference |
144-83-2(CAS DataBase Reference) |
| NIST Chemistry Reference |
Sulfapyridine(144-83-2) |
| EPA Substance Registry System |
Sulfapyridine (144-83-2) |
