| Melting point |
111 °C (dec.)(lit.) |
| Boiling point |
356.8°C (rough estimate) |
| Density |
1.1303 (rough estimate) |
| vapor pressure |
3 x 10-7 mmHg (estimated, NIOSH, 1997) |
| refractive index |
1.5770 (estimate) |
| storage temp. |
Store at RT. |
| solubility |
Insoluble in water; soluble in ethanol, benzene, ether, chloroform,petroleum ether, mineralacids, oils |
| Colour Index |
11020 |
| form |
Powder |
| pka |
3.226(at 25℃) |
| color |
Yellow |
| PH |
2.9-4.0 |
| PH Range |
2.9(red)-4(yellow/orange) |
| Water Solubility |
13.6 mg/L |
| λmax |
408nm, 256nm, 508nm |
| Merck |
14,3229 |
| BRN |
746016 |
| Stability |
Stable, but heat and light sensitive. Incompatible with strong oxidizing agents, strong acids. |
| Major Application |
Electrochromic materials, sol-gel coatings, display device, inks, gasdetection apparatus, status assessment indetection apparatus, nematocides, hair dyes, diapers, food storage, status assessment inbreast cancer, detecting carbohydrates, bacteria, diagnosing cervical disease, wound dressing materials |
| InChI |
1S/C14H15N3/c1-17(2)14-10-8-13(9-11-14)16-15-12-6-4-3-5-7-12/h3-11H,1-2H3 |
| InChIKey |
JCYPECIVGRXBMO-UHFFFAOYSA-N |
| SMILES |
CN(C)c1ccc(cc1)N=Nc2ccccc2 |
| CAS DataBase Reference |
60-11-7(CAS DataBase Reference) |
| IARC |
2B (Vol. 8, Sup 7) 1987 |
| NIST Chemistry Reference |
Benzenamine, N,N-dimethyl-4-(phenylazo)-(60-11-7) |
| EPA Substance Registry System |
4-Dimethylaminoazobenzene (60-11-7) |