| Melting point |
318.5 - 320.5° |
| Boiling point |
582.9±45.0 °C(Predicted) |
| Density |
1.570±0.06 g/cm3(Predicted) |
| storage temp. |
2-8°C |
| solubility |
DMSO: ≥14mg/mL |
| pka |
10.75±0.40(Predicted) |
| form |
powder |
| color |
yellow |
| Merck |
14,135 |
| Stability |
Stable for 1 year from date of purchase as supplied. Solutions in DMSO may be stored at -20° for up to 1 month. |
| InChI |
InChI=1S/C13H11N3O4/c14-7-3-1-2-6-10(7)13(20)16(12(6)19)8-4-5-9(17)15-11(8)18/h1-3,8H,4-5,14H2,(H,15,17,18) |
| InChIKey |
UVSMNLNDYGZFPF-UHFFFAOYSA-N |
| SMILES |
C1(=O)C2=C(C(N)=CC=C2)C(=O)N1C1CCC(=O)NC1=O |
