| Melting point |
6.1°C |
| Boiling point |
375°C |
| Density |
1.26 |
| vapor pressure |
0.470 at 20 °C, 0.942 at 25 °C, 1.84 at 30 °C, 3.53 at 35 °C, 6.62 at 40 °C, 12.18 at 45 °C (gassaturation method, Spencer et al., 1979) |
| refractive index |
nD25 1.5370 |
| Flash point |
120 °C |
| storage temp. |
APPROX 4°C |
| solubility |
2,900 and 2,700 g/kg in petroleum ether and heptane, respectively (Williams, 1951) |
| form |
liquid |
| color |
Pale-yellow liquid |
| Water Solubility |
Slightly soluble |
| Merck |
13,7105 |
| BRN |
8912188 |
| Henry's Law Constant |
8.56 at 25 °C (wetted-wall column, Fendinger and Glotfelty, 1990) |
| Exposure limits |
NIOSH REL: TWA 0.05 mg/m3, IDLH 10 mg/m3; OSHA PEL: TWA
0.1 mg/m3. |
| Stability |
Hygroscopic, Moisture Sensitive |
| InChI |
1S/C10H14NO5PS/c1-3-14-17(18,15-4-2)16-10-7-5-9(6-8-10)11(12)13/h5-8H,3-4H2,1-2H3 |
| InChIKey |
LCCNCVORNKJIRZ-UHFFFAOYSA-N |
| SMILES |
CCOP(=S)(OCC)Oc1ccc(cc1)[N+]([O-])=O |
| CAS DataBase Reference |
56-38-2(CAS DataBase Reference) |
| IARC |
2B (Vol. 30, Sup 7, 112) 2017 |
| NIST Chemistry Reference |
Ethyl parathion (o,o-diethyl-o-p-nitrophenylthiophosphate)(56-38-2) |
| EPA Substance Registry System |
Parathion (56-38-2) |
