| Melting point |
34° |
| alpha |
D18 +106° (c = 2) |
| Boiling point |
bp5 260° (partial conversion to isopilocarpine) |
| Density |
1.1123 (rough estimate) |
| refractive index |
1.5000 (estimate) |
| solubility |
Chloroform (Sparingly, Sonicated), Methanol (Slightly) |
| pka |
6.87(at 30℃) |
| form |
<34°C Solid,>34°C Liquid |
| color |
Colorless to light yellow |
| optical activity |
+10618 (H2O) |
| InChI |
InChI=1S/C11H16N2O2/c1-3-10-8(6-15-11(10)14)4-9-5-12-7-13(9)2/h5,7-8,10H,3-4,6H2,1-2H3/t8-,10-/m0/s1 |
| InChIKey |
QCHFTSOMWOSFHM-WPRPVWTQSA-N |
| SMILES |
O1C[C@H](CC2N(C)C=NC=2)[C@H](CC)C1=O |
| LogP |
0.120 |
| CAS DataBase Reference |
92-13-7(CAS DataBase Reference) |
| EPA Substance Registry System |
2(3H)-Furanone, 3-ethyldihydro-4-[(1-methyl-1H-imidazol-5-yl)methyl]-, (3S,4R)- (92-13-7) |
