| Melting point |
290 °C (dec.) (lit.) |
| Boiling point |
441.31°C (rough estimate) |
| Density |
1.1590 (rough estimate) |
| bulk density |
350-500kg/m3 |
| refractive index |
1.6110 (estimate) |
| storage temp. |
Store at +5°C to +30°C. |
| solubility |
H2O: soluble10mg/mL |
| form |
Solid |
| Colour Index |
50040 |
| pka |
6.7, 7.4(at 25℃) |
| color |
Very dark green |
| PH Range |
6.8(red)-8(yellow) |
| PH |
3.1 (10g/l, H2O, 20℃) |
| Odor |
Odorless |
| Appearance |
Solid Powder |
| Water Solubility |
50 g/L |
| λmax |
540nm, 533nm, 544nm, 529nm, 454nm |
| Merck |
14,6488 |
| BRN |
3918740 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Biological Applications |
Detecting pathogens,bacterial infections; treating age-related macular degeneration,burns,cancer,diabetes,obesity,fungal infections,viral diseases |
| Major Application |
Fuel cell power generation system, liquid crystal displays, solor cells, sensors, thermochromic materials, coloring wood, detergents, assessment of tobacco smoke, cosmetics, detect bacterial infections, multidrug resistance inhibitors, treatment of burns, endodontic, diabetes, obesity, cancer, age-related macular degeneration, viral diseases |
| InChI |
1S/C15H16N4.ClH/c1-9-6-13-15(8-11(9)16)18-14-7-10(19(2)3)4-5-12(14)17-13;/h4-8H,16H2,1-3H3;1H |
| InChIKey |
PGSADBUBUOPOJS-UHFFFAOYSA-N |
| SMILES |
Cl.CN(C)c1ccc2nc3cc(C)c(N)cc3nc2c1 |
| CAS DataBase Reference |
553-24-2(CAS DataBase Reference) |
| EPA Substance Registry System |
Neutral Red (553-24-2) |