| Melting point |
185-190 °C |
| Boiling point |
433.31°C (rough estimate) |
| Density |
d420 1.40 |
| refractive index |
1.4800 (estimate) |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
DMF: 25 mg/ml; DMF:PBS (pH 7.2) (1:3): 0.25 mg/ml; DMSO: 15 mg/ml |
| form |
Solid |
| pka |
3.45±0.36(Predicted) |
| color |
White to Gray to Dark blue |
| biological source |
rabbit |
| Water Solubility |
0.2g/L(room temperature) |
| Merck |
14,6418 |
| BRN |
2814102 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Major Application |
agriculture
environmental |
| InChI |
1S/C18H13NO3/c20-17(14-9-3-4-10-15(14)18(21)22)19-16-11-5-7-12-6-1-2-8-13(12)16/h1-11H,(H,19,20)(H,21,22) |
| InChIKey |
JXTHEWSKYLZVJC-UHFFFAOYSA-N |
| SMILES |
OC(=O)c1ccccc1C(=O)Nc2cccc3ccccc23 |
| CAS DataBase Reference |
132-66-1(CAS DataBase Reference) |
| EPA Substance Registry System |
Naptalam (132-66-1) |
