| Melting point |
179-182 °C (lit.) |
| Boiling point |
412.44°C (rough estimate) |
| Density |
0.839 g/mL at 25 °C |
| bulk density |
300-500kg/m3 |
| vapor density |
9.3 (vs air) |
| refractive index |
1.5930 (estimate) |
| Flash point |
11 °C |
| storage temp. |
Store at +5°C to +30°C. |
| solubility |
ethanol: soluble1mg/mL |
| Colour Index |
13020 |
| form |
Solid |
| pka |
4.95(at 25℃) |
| color |
Reddish-violet |
| Odor |
Odorless |
| PH Range |
4.4(red)-6.3(yellow) |
| Water Solubility |
Practically insoluble in water. Soluble in alcohol, acetic acidSoluble in ethanol. Insoluble in water. |
| ε(extinction coefficient) |
≥10000 at 282-288nm in methanol ≥20000 at 509-519nm in methanol ≥7000 at 329-335nm in methanol |
| λmax |
410nm, 530nm, 427nm, 519nm |
| Merck |
14,6119 |
| BRN |
750102 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Major Application |
Waveguides, LED sensors, photoresists, liquid crystals, sol-gel matrix, optical sensors, paints, toys, detection of thiols, food freshness sensors, dental product, saliva sampling method, detecting lactic acid, carbohydrates |
| InChI |
1S/C15H15N3O2/c1-18(2)12-9-7-11(8-10-12)16-17-14-6-4-3-5-13(14)15(19)20/h3-10H,1-2H3,(H,19,20) |
| InChIKey |
CEQFOVLGLXCDCX-MSUUIHNZSA-N |
| SMILES |
N(C)(C)c1ccc(cc1)N=Nc2c(cccc2)C(=O)O |
| CAS DataBase Reference |
493-52-7 |
| IARC |
3 (Vol. 8, Sup 7) 1987 |
| NIST Chemistry Reference |
Benzoic acid, 2-[[4-(dimethylamino)phenyl]azo]-(493-52-7) |
| EPA Substance Registry System |
Methyl red (493-52-7) |