| Melting point |
>300 °C(lit.) |
| Boiling point |
405.51°C (rough estimate) |
| Density |
1.01 g/mL at 20 °C |
| vapor pressure |
0Pa at 100℃ |
| refractive index |
1.5800 (estimate) |
| Flash point |
>220℃ |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
DMSO (Slightly, Heated, Sonicated), DMF (Slightly) |
| form |
Powder |
| Colour Index |
73000 |
| pka |
-3.83±0.20(Predicted) |
| color |
Dark blue to violet |
| Water Solubility |
<0.1 g/100 mL |
| λmax |
602 nm |
| ε(extinction coefficient) |
≥8000 at 599-605nm in chloroform |
| Merck |
14,4943 |
| BRN |
88275 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Major Application |
diagnostic assay manufacturing hematology histology |
| Cosmetics Ingredients Functions |
COLORANT |
| InChI |
1S/C16H10N2O2/c19-15-9-5-1-3-7-11(9)17-13(15)14-16(20)10-6-2-4-8-12(10)18-14/h1-8,17-18H/b14-13+ |
| InChIKey |
COHYTHOBJLSHDF-BUHFOSPRSA-N |
| SMILES |
O=C1C(\Nc2ccccc12)=C3/Nc4ccccc4C3=O |
| LogP |
2.7 at 23℃ |
| CAS DataBase Reference |
482-89-3(CAS DataBase Reference) |
| NIST Chemistry Reference |
c.i. Vat blue 1(482-89-3) |
| EPA Substance Registry System |
C.I. Vat Blue 1 (482-89-3) |