| Melting point |
197-199° |
| Density |
1.4069 (estimate) |
| vapor pressure |
5.9 x l0-5 Pa (25 °C) |
| storage temp. |
Sealed in dry,2-8°C |
| solubility |
DMF: 10 mg/ml,DMSO: 10 mg/ml,DMSO:PBS(pH 7.2) (1:2): 0.3 mg/ml |
| form |
Solid |
| Water Solubility |
2.7 x l0-22 mg l-1 (18 °C) |
| pka |
8.54±0.46(Predicted) |
| color |
Off-white to light yellow |
| BRN |
8168725 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| InChI |
InChI=1S/C16H8Cl2F6N2O3/c17-7-4-6(5-8(18)12(7)29-16(23,24)14(21)22)25-15(28)26-13(27)11-9(19)2-1-3-10(11)20/h1-5,14H,(H2,25,26,27,28) |
| InChIKey |
RGNPBRKPHBKNKX-UHFFFAOYSA-N |
| SMILES |
C(NC(NC1=CC(Cl)=C(OC(F)(F)C(F)F)C(Cl)=C1)=O)(=O)C1=C(F)C=CC=C1F |
| CAS DataBase Reference |
86479-06-3(CAS DataBase Reference) |
| EPA Substance Registry System |
Hexaflumuron (86479-06-3) |
