| Melting point |
253-255°C |
| Boiling point |
439.7±45.0 °C(Predicted) |
| Density |
1.45±0.1 g/cm3(Predicted) |
| RTECS |
DK1672000 |
| Flash point |
>110°(230°F) |
| storage temp. |
Sealed in dry,Store in freezer, under -20°C |
| solubility |
1 M NH4OH: soluble50mg/mL |
| pka |
pKa 6.42(H2O t=25.0 I=0.025)(Approximate) |
| form |
powder |
| color |
white to off-white |
| Water Solubility |
Soluble in DMSO and dilute alkali hydroxides. Insoluble in water |
| Merck |
14,4137 |
| BRN |
490724 |
| Henry's Law Constant |
3.7×107 mol/(m3Pa) at 25℃, HSDB (2015) |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Major Application |
agriculture environmental |
| InChI |
1S/C14H12FNO3/c1-7-2-3-8-4-9(15)5-10-12(8)16(7)6-11(13(10)17)14(18)19/h4-7H,2-3H2,1H3,(H,18,19) |
| InChIKey |
DPSPPJIUMHPXMA-UHFFFAOYSA-N |
| SMILES |
CC1CCc2cc(F)cc3C(=O)C(=CN1c23)C(O)=O |
| CAS DataBase Reference |
42835-25-6(CAS DataBase Reference) |
| EPA Substance Registry System |
1H,5H-Benzo[ij]quinolizine-2-carboxylic acid, 9-fluoro-6,7-dihydro-5-methyl-1-oxo- (42835-25-6) |