| Melting point |
158-159°C |
| Boiling point |
180-190°C |
| Density |
1.48 |
| vapor pressure |
2(x 10-7 mmHg) at 30 °C (Hawley, 1981) |
| refractive index |
1.5500 (estimate) |
| Flash point |
180-190°C |
| storage temp. |
2-8°C |
| solubility |
In acetone: 5.3 wt % at 27 °C (Meister, 1988). |
| form |
Solid |
| pka |
-1 to -2 (quoted, Bailey and White, 1965) |
| color |
White, odorless crystalline solid |
| Water Solubility |
Slightly soluble. 0.0042 g/100 mL |
| Merck |
14,3382 |
| BRN |
2215168 |
| Henry's Law Constant |
1.46(x 10-9 atmm3/mol) at 25 °C (approximate - calculated from water solubility and vapor pressure) |
| Exposure limits |
NIOSH REL: TWA 10 mg/m3. |
| Stability |
Stable. Incompatible with strong acids, strong bases, strong oxidizing agents. |
| Major Application |
agriculture cleaning products cosmetics environmental food and beverages personal care |
| InChI |
1S/C9H10Cl2N2O/c1-13(2)9(14)12-6-3-4-7(10)8(11)5-6/h3-5H,1-2H3,(H,12,14) |
| InChIKey |
XMTQQYYKAHVGBJ-UHFFFAOYSA-N |
| SMILES |
CN(C)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| LogP |
2.84-2.89 at 20℃ and pH4.03-9 |
| NIST Chemistry Reference |
Urea, 3-(3,4-dichlorophenyl)-1,1-dimethyl-(330-54-1) |
| EPA Substance Registry System |
Diuron (330-54-1) |