| Melting point |
168-172 °C (lit.) |
| Boiling point |
418.7±40.0 °C(Predicted) |
| Density |
1.3239 (estimate) |
| vapor pressure |
1.3 x 10-5 Pa (25 °C) |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
Soluble in methanol, ether |
| pka |
pK1:7.6;pK2:11.5 (25°C) |
| form |
Solid |
| color |
White to Light yellow to Light orange |
| Water Solubility |
<0.1 g/100 mL at 22 ºC |
| Merck |
14,3071 |
| BRN |
1884514 |
| Stability |
Stable. Incompatible with strong bases, strong oxidizing agents. |
| Cosmetics Ingredients Functions |
DEODORANT
ANTIMICROBIAL |
| InChI |
1S/C13H10Cl2O2/c14-10-1-3-12(16)8(6-10)5-9-7-11(15)2-4-13(9)17/h1-4,6-7,16-17H,5H2 |
| InChIKey |
MDNWOSOZYLHTCG-UHFFFAOYSA-N |
| SMILES |
Oc1ccc(Cl)cc1Cc2cc(Cl)ccc2O |
| LogP |
4.260 |
| CAS DataBase Reference |
97-23-4(CAS DataBase Reference) |
| NIST Chemistry Reference |
Phenol], 2,2'-methylenebis[4-chloro-(97-23-4) |
| EPA Substance Registry System |
Dichlorophene (97-23-4) |
