| Melting point |
≥300 °C |
| alpha |
[α]D20 0±0.5゜(c=2,1mol/l HCl) |
| Boiling point |
507.6±50.0 °C(Predicted) |
| Density |
1.4269 (rough estimate) |
| refractive index |
1.6300 (estimate) |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
Aqueous Acid (Slightly). Aqueous Base (Slightly) |
| form |
powder to crystal |
| pka |
1.90±0.10(Predicted) |
| color |
White to Light yellow |
| Water Solubility |
0.2g/L(25 ºC) |
| Merck |
14,4735 |
| BRN |
1728581 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Major Application |
detection |
| InChI |
1S/C8H16N2O4S2/c9-5(7(11)12)1-3-15-16-4-2-6(10)8(13)14/h5-6H,1-4,9-10H2,(H,11,12)(H,13,14)/t5-,6+ |
| InChIKey |
ZTVZLYBCZNMWCF-OLQVQODUSA-N |
| SMILES |
N[C@H](CCSSCC[C@H](N)C(O)=O)C(O)=O |
| CAS DataBase Reference |
870-93-9(CAS DataBase Reference) |
| EPA Substance Registry System |
Butanoic acid, 4,4'-dithiobis[2-amino-, (2R,2'R)-rel- (870-93-9) |