| Melting point |
<40℃ |
| Boiling point |
195 °C/0.04 mmHg (lit.) |
| Density |
0.988 g/mL at 25 °C (lit.) |
| refractive index |
n20/D 1.485(lit.) |
| Flash point |
>230 °F |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
Chloroform (Slightly), Methanol (Slightly) |
| form |
Oil |
| color |
Colourless |
| Water Solubility |
Sparingly soluble in water. |
| BRN |
2336623 |
| Henry's Law Constant |
5.9×10-1 mol/(m3Pa) at 25℃, Cousins and Mackay (2000) |
| Major Application |
cleaning products cosmetics food and beverages personal care |
| InChI |
1S/C22H34O4/c1-3-5-7-9-13-17-25-21(23)19-15-11-12-16-20(19)22(24)26-18-14-10-8-6-4-2/h11-12,15-16H,3-10,13-14,17-18H2,1-2H3 |
| InChIKey |
JQCXWCOOWVGKMT-UHFFFAOYSA-N |
| SMILES |
CCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCC |
| CAS DataBase Reference |
3648-21-3(CAS DataBase Reference) |
| EPA Substance Registry System |
Diheptyl phthalate (3648-21-3) |