| Melting point |
178-182 °C (lit.) |
| Boiling point |
204 °C |
| alpha |
D25 +41 to +43° (c = 10 in U.S.P. alcohol) according to U.S.P. specif |
| Density |
0,99 g/cm3 |
| vapor density |
5.24 (vs air) |
| vapor pressure |
4 mm Hg ( 70 °C) |
| refractive index |
44.5 ° (C=20, EtOH) |
| FEMA |
2230 | D-CAMPHOR |
| Flash point |
148 °F |
| storage temp. |
2-8°C |
| solubility |
Slightly soluble in water, very soluble in alcohol and in light petroleum, freely soluble in fatty oils, very slightly soluble in glycerol. |
| form |
Crystals |
| color |
White |
| Odor |
at 10.00 % in dipropylene glycol. camphor minty phenolic herbal woody |
| Odor Type |
camphoreous |
| biological source |
synthetic |
| optical activity |
[α]25/D +44°, c = 10 in ethanol |
| explosive limit |
3.5% |
| Water Solubility |
Soluble in water (0.1 g/L at 20°C). |
| Merck |
14,1732 |
| JECFA Number |
1395 |
| BRN |
2042745 |
| Stability |
Stable. Incompatible with strong reducing agents, strong oxidizing agents, chlorinated solvents. Protect from direct sunlight. |
| Cosmetics Ingredients Functions |
DENATURANT
FRAGRANCE
PLASTICISER |
| InChI |
1S/C10H16O/c1-9(2)7-4-5-10(9,3)8(11)6-7/h7H,4-6H2,1-3H3/t7-,10+/m1/s1 |
| InChIKey |
DSSYKIVIOFKYAU-XCBNKYQSSA-N |
| SMILES |
C[C@@]1(CC2)C(C)(C)[C@H]2CC1=O |
| LogP |
2.3 at 20℃ |
| CAS DataBase Reference |
464-49-3(CAS DataBase Reference) |
| EPA Substance Registry System |
D-Camphor (464-49-3) |
