| Melting point |
261 °C |
| Boiling point |
583.0±50.0 °C(Predicted) |
| Density |
1.4641 (estimate) |
| bulk density |
720kg/m3 |
| storage temp. |
Store below +30°C. |
| solubility |
Solubility Sparingly soluble in water; soluble in ethanol |
| form |
Liquid |
| pka |
6.0(at 25℃) |
| color |
White to cream |
| PH Range |
4.8(yellow)-6.8(red) |
| PH |
4.8-6.7, yellow to violet |
| Water Solubility |
insoluble |
| λmax |
572nm |
| ε(extinction coefficient) |
≥12000 at 295-301nm in 0.1 M NaOH ≥45000 at 573-579nm in 0.1 M NaOH ≥5000 at 368-374nm in 0.1 M NaOH |
| BRN |
354053 |
| Major Application |
Waveguide, sol-gel matrix, display device, tin electroplating process, inks, lubricants, detergents, preservation of cut flowers, cosmetics, identifying fresh and stale rice, determining acidity in wine, food storage, detecting lactic acid bacteria, enzyme assays, diagnosis of bacterial and fungal infection, oral hygiene products |
| InChI |
1S/C19H12Cl2O5S/c20-14-9-11(5-7-16(14)22)19(12-6-8-17(23)15(21)10-12)13-3-1-2-4-18(13)27(24,25)26-19/h1-10,22-23H |
| InChIKey |
WWAABJGNHFGXSJ-UHFFFAOYSA-N |
| SMILES |
Oc1ccc(cc1Cl)C2(OS(=O)(=O)c3ccccc23)c4ccc(O)c(Cl)c4 |
| CAS DataBase Reference |
4430-20-0(CAS DataBase Reference) |
| EPA Substance Registry System |
Phenol, 4,4'-(1,1-dioxido-3H-2,1-benzoxathiol-3-ylidene)bis[2-chloro- (4430-20-0) |