| Melting point |
62-65 °C(lit.) |
| Boiling point |
210-220 C |
| Density |
1.1037 (rough estimate) |
| refractive index |
1.5100 (estimate) |
| FEMA |
3404 | CAPSAICIN |
| Flash point |
113 °C |
| storage temp. |
2-8°C |
| solubility |
H2O: insoluble |
| form |
Off-white solid |
| pka |
9.76±0.20(Predicted) |
| color |
Off-white |
| Odor |
mild warm herbal |
| Odor Type |
herbal |
| biological source |
Capsicum sp. |
| Water Solubility |
insoluble |
| Merck |
14,1768 |
| BRN |
2816484 |
| Henry's Law Constant |
9.9×107 mol/(m3Pa) at 25℃, HSDB (2015) |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Major Application |
metabolomics vitamins, nutraceuticals, and natural products |
| Cosmetics Ingredients Functions |
SKIN CONDITIONING FRAGRANCE |
| Cosmetic Ingredient Review (CIR) |
Capsaicin (404-86-4) |
| InChI |
1S/C18H27NO3/c1-14(2)8-6-4-5-7-9-18(21)19-13-15-10-11-16(20)17(12-15)22-3/h6,8,10-12,14,20H,4-5,7,9,13H2,1-3H3,(H,19,21)/b8-6+ |
| InChIKey |
YKPUWZUDDOIDPM-SOFGYWHQSA-N |
| SMILES |
COc1cc(CNC(=O)CCCC\C=C\C(C)C)ccc1O |
| LogP |
4.00 |
| CAS DataBase Reference |
404-86-4(CAS DataBase Reference) |
| EPA Substance Registry System |
Capsaicin (404-86-4) |