| Melting point |
245-246°C |
| Boiling point |
472.86°C (rough estimate) |
| Density |
1.2171 (rough estimate) |
| refractive index |
1.5700 (estimate) |
| storage temp. |
-20°C |
| solubility |
DMSO: soluble |
| form |
powder |
| pka |
4.50±1.00(Predicted) |
| color |
white to off-white |
| Water Solubility |
Soluble in DMSO (100 mM), ethanol (5 mM), DMF (~20 mg/ml), and 1:1 DMSO:PBS(pH 7.2) (0.5 mg/ml). Insoluble in water. |
| InChI |
1S/C20H22N2O3/c1-10(23)15-18(24)17-12-9-21-14-7-5-6-11(16(12)14)8-13(17)20(2,3)22(4)19(15)25/h5-7,9,13,17,21,23H,8H2,1-4H3/b15-10- |
| InChIKey |
WJCPGKDPOYBOOJ-GDNBJRDFSA-N |
| SMILES |
CN1C(=O)C(=C(\C)O)\C(=O)C2C(Cc3cccc4[nH]cc2c34)C1(C)C |
| EPA Substance Registry System |
Cyclopiazonic acid (18172-33-3) |
