| Melting point |
69-73 °C(lit.) |
| Boiling point |
265 °C(lit.) |
| bulk density |
450kg/m3 |
| Density |
1.048 |
| vapor density |
7.6 (vs air) |
| vapor pressure |
<0.01 mm Hg ( 20 °C) |
| FEMA |
2184 | BUTYLATED HYDROXYTOLUENE |
| refractive index |
1.4859 |
| Flash point |
127 °C |
| storage temp. |
2-8°C |
| solubility |
methanol: 0.1 g/mL, clear, colorless |
| pka |
pKa 14(H2O
t = 25
c = 0.002 to 0.01) (Uncertain) |
| form |
Crystals |
| color |
white |
| Odor |
faint characteristic odor |
| biological source |
synthetic |
| Odor Type |
phenolic |
| Water Solubility |
insoluble |
| Merck |
14,1548 |
| BRN |
1911640 |
| Exposure limits |
ACGIH: TWA 2 mg/m3
NIOSH: TWA 10 mg/m3 |
| Stability |
Stable, but light-sensitive. Incompatible with acid chlorides, acid anhydrides, brass, copper, copper alloys, steel, bases, oxidizing agents. Combustible. |
| Major Application |
flavors and fragrances |
| Cosmetics Ingredients Functions |
ANTIOXIDANT
FRAGRANCE |
| Cosmetic Ingredient Review (CIR) |
Butylated Hydroxytoluene (128-37-0) |
| InChI |
1S/C15H24O/c1-10-8-11(14(2,3)4)13(16)12(9-10)15(5,6)7/h8-9,16H,1-7H3 |
| InChIKey |
NLZUEZXRPGMBCV-UHFFFAOYSA-N |
| SMILES |
Cc1cc(c(O)c(c1)C(C)(C)C)C(C)(C)C |
| LogP |
5.2 |
| CAS DataBase Reference |
128-37-0(CAS DataBase Reference) |
| IARC |
3 (Vol. 40, Sup 7) 1987 |
| NIST Chemistry Reference |
Butylated hydroxytoluene(128-37-0) |
| EPA Substance Registry System |
2,6-Di-tert-butyl-p-cresol (128-37-0) |
