| Melting point |
158-163℃ |
| Boiling point |
785.6±60.0 °C(Predicted) |
| Density |
1.83±0.1 g/cm3(Predicted) |
| vapor pressure |
0Pa at 25℃ |
| storage temp. |
Keep in dark place,Sealed in dry,Room Temperature |
| solubility |
DMSO (Slightly), Methanol (Slightly) |
| pka |
3.38±0.10(Predicted) |
| form |
Powder |
| color |
White to Off-white |
| Water Solubility |
Soluble in water. (879 g/L) at 25°C. |
| λmax |
260nm(H2O)(lit.) |
| Cosmetics Ingredients Functions |
ANTIOXIDANT |
| InChI |
1S/C12H18O11/c13-1-3(15)9-8(19)10(11(20)22-9)23-12-7(18)6(17)5(16)4(2-14)21-12/h3-7,9,12-19H,1-2H2/t3-,4+,5+,6-,7+,9+,12+/m0/s1 |
| InChIKey |
MLSJBGYKDYSOAE-DCWMUDTNSA-N |
| SMILES |
OC([C@]([C@@H](O)CO)([H])O1)=C(C1=O)O[C@H]([C@@H]([C@@H](O)[C@@H]2O)O)O[C@@H]2CO |
| LogP |
-2 at 20℃ |
| Surface tension |
71mN/m at 1g/L and 20℃ |
