| Density |
1.3588 (rough estimate) |
| vapor pressure |
0Pa at 25℃ |
| refractive index |
1.6500 (estimate) |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| form |
powder to crystal |
| pka |
-0.08±0.40(Predicted) |
| color |
White to Light yellow to Light orange |
| Water Solubility |
0.12g/L(20 ºC) |
| InChI |
InChI=1S/C10H9NO3S/c11-9-3-1-8-6-10(15(12,13)14)4-2-7(8)5-9/h1-6H,11H2,(H,12,13,14) |
| InChIKey |
SEMRCUIXRUXGJX-UHFFFAOYSA-N |
| SMILES |
C1=C2C(C=C(N)C=C2)=CC=C1S(O)(=O)=O |
| LogP |
0.603 at 25℃ |
| CAS DataBase Reference |
93-00-5(CAS DataBase Reference) |
| EPA Substance Registry System |
6-Amino-2-naphthalenesulfonic acid (93-00-5) |