| Melting point |
199-201 °C(lit.) |
| Boiling point |
531.2±45.0 °C(Predicted) |
| Density |
1.26 |
| refractive index |
1.6360 (estimate) |
| Flash point |
>350°C |
| storage temp. |
Keep in dark place,Sealed in dry,Room Temperature |
| solubility |
toluene: soluble50mg/mL |
| pka |
3.03±0.10(Predicted) |
| form |
powder |
| color |
Pale Green to Yellow |
| Appearance |
Pale green to yellow solid |
| Water Solubility |
Soluble in acetone and toluene. Insoluble in water. |
| λmax |
373nm(EtOH)(lit.) |
| ε(extinction coefficient) |
≥47000 at 372-374nm in dioxane |
| Merck |
14,1014 |
| BRN |
631803 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Major Application |
diagnostic assay manufacturing hematology histology |
| Cosmetics Ingredients Functions |
SKIN CONDITIONING - MISCELLANEOUS |
| InChI |
1S/C26H26N2O2S/c1-25(2,3)15-7-9-19-17(13-15)27-23(29-19)21-11-12-22(31-21)24-28-18-14-16(26(4,5)6)8-10-20(18)30-24/h7-14H,1-6H3 |
| InChIKey |
AIXZBGVLNVRQSS-UHFFFAOYSA-N |
| SMILES |
CC(C)(C)c1ccc2oc(nc2c1)-c3ccc(s3)-c4nc5cc(ccc5o4)C(C)(C)C |
| LogP |
8.6 at 25℃ |
| CAS DataBase Reference |
7128-64-5(CAS DataBase Reference) |
| NIST Chemistry Reference |
Benzoxazole, 2,2'-(2,5-thiophenediyl)bis[5-(1,1-dimethylethyl)-(7128-64-5) |
| EPA Substance Registry System |
2,2'-(2,5-Thiophenediyl)bis[5-tert-butylbenzoxazole] (7128-64-5) |