| Boiling point |
171-174 °C11 mm Hg(lit.) |
| Density |
1.16 g/mL at 25 °C(lit.) |
| refractive index |
n20/D 1.442(lit.) |
| Flash point |
>230 °F |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
Chloroform (Sparingly), Methanol (Slightly) |
| form |
Liquid |
| Specific Gravity |
1.160 |
| color |
Clear yellow to yellow-brown |
| Water Solubility |
Slightly miscible with water. |
| BRN |
1813241 |
| InChI |
InChI=1S/C9H22O6P2/c1-5-12-16(10,13-6-2)9-17(11,14-7-3)15-8-4/h5-9H2,1-4H3 |
| InChIKey |
STJWVOQLJPNAQL-UHFFFAOYSA-N |
| SMILES |
C(P(=O)(OCC)OCC)P(=O)(OCC)OCC |
| CAS DataBase Reference |
1660-94-2(CAS DataBase Reference) |
| EPA Substance Registry System |
Phosphonic acid, methylenebis-, tetraethyl ester (1660-94-2) |