Метомидат
- английское имяmetomidate
- CAS №5377-20-8
- CBNumberCB9913785
- ФормулаC13H14N2O2
- мольный вес230.26
- EINECS226-368-4
- номер MDLMFCD01721714
- файл Mol5377-20-8.mol
химическое свойство
| Температура кипения | 372.26°C (rough estimate) |
| плотность | 1.13 |
| показатель преломления | 1.6450 (estimate) |
| температура хранения | Refrigerator |
| растворимость | Chloroform, Methanol |
| пка | 4.15±0.23(Predicted) |
| цвет | Colourless to Pale Yellow |
| InChI | InChI=1S/C13H14N2O2/c1-10(11-6-4-3-5-7-11)15-9-14-8-12(15)13(16)17-2/h3-10H,1-2H3 |
| ИнЧИКей | FHFZEKYDSVTYLL-UHFFFAOYSA-N |
| SMILES | C1N(C(C2=CC=CC=C2)C)C(C(OC)=O)=CN=1 |
| FDA UNII | Z18ZYL8Y51 |
Метомидат химические свойства, назначение, производство
Химические свойства
Colourless Hazy OilИспользование
Metomidate is a the methyl ester analogue of Etomidate (E933300), with sedative and hypnotic properties. Metomidate is mainly used as an anesthetic for veterinary use on its own or in combination with Azaperone (A802200) and other sedatives.Механизм действия
Metomidate reduces plasma cortisol and glucose concentrations and increases fish pigmentation, presumably because of increased production of melanocyte-stimulating hormone on the same primary protein as adrenocorticotropic hormone (ACTH). Imidazole anesthetics (e.g., metomidate and etomidate) interrupt cortisol synthesis in mammals by suppressing the enzyme 11-beta-hydroxylase, which is necessary for cortisol production.Метомидат поставщик
| поставщик | телефон | страна | номенклатура продукции | благоприятные условия |
|---|---|---|---|---|
| +8613043004613 | China | 283 | 58 | |
| 18871490254 | CHINA | 28172 | 58 | |
| 00852-68527855 | China Hong Kong | 902 | 58 | |
| +8618523575427 | China | 49732 | 58 | |
| +1-781-999-5354 +1-00000000000 |
United States | 32161 | 58 | |
| +1-2135480471 +1-2135480471 |
China | 10473 | 58 | |
| +8618829768577 | China | 1249 | 58 | |
| +86-057181025280; +8617767106207 |
China | 49734 | 58 | |
| +86-37155567971 +86-13633837469 |
China | 5996 | 58 | |
| +8615391658522 | China | 11922 | 58 |