Acid-PEG5-NHS ester

Description: Acid-PEG5-NHS ester is a PEG derivative containing a carboxylic acid and an NHS ester. The hydrophilic PEG spacer increases solubility in aqueous media. The terminal carboxylic acid can be reacted with primary amine groups in the presence of activators (e.g. EDC, or DCC) to form a stable amide bond. The NHS ester can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules.

Name: Acid-PEG5-NHS ester
CAS#: 1343476-41-4
Chemical Formula: C18H29NO11
Exact Mass: 435.1741
Molecular Weight: 435.43
Elemental Analysis: C, 49.65; H, 6.71; N, 3.22; O, 40.42

IUPAC/Chemical Name: 19-((2,5-dioxopyrrolidin-1-yl)oxy)-19-oxo-4,7,10,13,16-pentaoxanonadecanoic acid

InChi Key: QMACGMMKGUAJOY-UHFFFAOYSA-N

InChi Code: InChI=1S/C18H29NO11/c20-15-1-2-16(21)19(15)30-18(24)4-6-26-8-10-28-12-14-29-13-11-27-9-7-25-5-3-17(22)23/h1-14H2,(H,22,23)

SMILES Code: O=C(ON1C(CCC1=O)=O)CCOCCOCCOCCOCCOCCC(O)=O

Appearance: Solid powder