Pentynoic acid STP ester

Name: Pentynoic acid STP ester
CAS#: 1807530-14-8
Chemical Formula: C11H5F4NaO5S
Exact Mass: 347.9692
Molecular Weight: 348.2
Elemental Analysis: C, 37.94; H, 1.45; F, 21.82; Na, 6.60; O, 22.97; S, 9.21

Description: This water soluble alkyne activated ester reagent is used for the attachment of alkyne group to variois biomolecules such as proteins, and peptides. Amino-DNA, and other amines can be used as well. Since natural proteins do not contain alkynes, but almost always contain amines (lysines), this molecule is an "adaptor" to turn natural amines into alkynes.

IUPAC/Chemical Name: 4-Pentynoic acid, 2,3,5,6-tetrafluoro-4-sulfophenyl ester, sodium salt

InChi Key: QVSTTZKAIDTZNG-UHFFFAOYSA-M

InChi Code: InChI=1S/C11H6F4O5S.Na/c1-2-3-4-5(16)20-10-6(12)8(14)11(21(17,18)19)9(15)7(10)13;/h1H,3-4H2,(H,17,18,19);/q;+1/p-1

SMILES Code: C#CCCC(OC1=C(F)C(F)=C(S(=O)([O-])=O)C(F)=C1F)=O.[Na+]

Appearance: Solid powder