MDVN1003

Name: MDVN1003
CAS#: 2058116-52-0
Chemical Formula: C22H20FN7O
Exact Mass: 417.1713
Molecular Weight: 417.4484
Elemental Analysis: C, 63.30; H, 4.83; F, 4.55; N, 23.49; O, 3.83

Description: MDVN1003 is a potent inhibitor of BTK amd PI3K delta. MDVN1003 inhibits Bruton's tyrosine kinase (BTK) and phosphatidylinositol-3-kinase delta (PI3Kδ), two proteins regulated by the B cell receptor (BCR) that drive the growth of many NHLs. MDVN1003 induces cell death in a B cell lymphoma cell line but not in an irrelevant erythroblast cell line.

IUPAC/Chemical Name: 1-(5-amino-2,3-dihydro-1H-inden-2-yl)-3-(8-fluoro-3,4-dihydro-2H-benzo[b][1,4]oxazin-6-yl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine

InChi Key: ULJLSBKQZMEISX-UHFFFAOYSA-N

InChi Code: InChI=1S/C22H20FN7O/c23-16-8-13(9-17-20(16)31-4-3-26-17)19-18-21(25)27-10-28-22(18)30(29-19)15-6-11-1-2-14(24)5-12(11)7-15/h1-2,5,8-10,15,26H,3-4,6-7,24H2,(H2,25,27,28)

SMILES Code: NC1=C2C(N(C3CC(C=CC(N)=C4)=C4C3)N=C2C5=CC(NCCO6)=C6C(F)=C5)=NC=N1

Appearance: Solid powder