| CAS: | 16595-80-5 |
| MF: | C11H13ClN2S |
| MW: | 240.75 |
| EINECS: | 240-654-6 |
| Product Categories: | Other APIs;REZIFILM;Aromatics;Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals;Asymmetric Synthesis;Synthetic Organic Chemistry;Antibiotic Explorer;Veterinaries;Protein Phosphatase;Sulfur & Selenium Compounds;Pharma;Pharmaceutical intermediate;API;16595-80-5 |
| Mol File: | 16595-80-5.mol |
 |
|
| Levamisole hydrochloride Chemical Properties |
| Melting point | 266-267 °C(lit.) |
| alpha | -128 º (c=5, H2O) |
| refractive index | -126 ° (C=1, H2O) |
| Fp | 9℃ |
| storage temp. | 2-8°C |
| solubility | Freely soluble in water, soluble in ethanol (96 per cent), slightly soluble in methylene chloride. |
| form | Crystalline Powder |
| color | White to almost white |
| Water Solubility | 210 g/L (20 ºC) |
| Merck | 14,5459 |
| BRN | 4358988 |
| BCS Class | 3/1 |
| Stability: | Hygroscopic |
| InChI | InChI=1/C11H12N2S.ClH/c1-2-4-9(5-3-1)10-8-13-6-7-14-11(13)12-10;/h1-5,10H,6-8H2;1H/t10-;/s3 |
| InChIKey | LAZPBGZRMVRFKY-HNCPQSOCSA-N |
| SMILES | [C@H]1(N=C2SCCN2C1)C1=CC=CC=C1.Cl |&1:0,r| |
| LogP | 1.845 (est) |
| CAS DataBase Reference | 16595-80-5(CAS DataBase Reference) |
| EPA Substance Registry System | Levamisole hydrochloride (16595-80-5) |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T，USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.
China
