| CAS: | 171596-29-5 |
| MF: | C22H19N3O4 |
| MW: | 389.4 |
| EINECS: | 687-782-2 |
| Product Categories: | 11;Steroid and Hormone;Inhibitors;Intermediates & Fine Chemicals;Pharmaceuticals;API's;Active Pharmaceutical Ingredients;Cnbio;Erectile Dysfunction;Inhibitor;API;Tadalafil;NUCYNTA;Pyridines ,Halogenated Heterocycles;171596-29-5;sex |
| Mol File: | 171596-29-5.mol |
 |
|
| Tadalafil Chemical Properties |
| Melting point | 298-300°C |
| alpha | D20 +71.0° |
| Boiling point | 679.1±55.0 °C(Predicted) |
| density | 1.51±0.1 g/cm3(Predicted) |
| Fp | 2℃ |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMSO: soluble20mg/mL, clear |
| form | powder |
| pka | 16.68±0.40(Predicted) |
| color | white to beige |
| optical activity | [α]/D +68 to +78°, c = 1 in chloroform-d |
| BCS Class | 4 |
| Stability: | Unstable in Methanol |
| InChI | InChI=1S/C22H19N3O4/c1-24-10-19(26)25-16(22(24)27)9-14-13-4-2-3-5-15(13)23-20(14)21(25)12-6-7-17-18(8-12)29-11-28-17/h2-8,16,21,23H,9-11H2,1H3/t16-,21-/m1/s1 |
| InChIKey | WOXKDUGGOYFFRN-IIBYNOLFSA-N |
| SMILES | N1C2=C(C=CC=C2)C2C[C@]3([H])C(=O)N(C)CC(=O)N3[C@H](C3=CC=C4OCOC4=C3)C1=2 |
| CAS DataBase Reference | 171596-29-5(CAS DataBase Reference) |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T，USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.
China
