| CAS: | 7331-52-4 |
| MF: | C4H6O3 |
| MW: | 102.09 |
| EINECS: | 434-990-4 |
| Product Categories: | Chiral Building Blocks;Simple Alcohols (Chiral);chiral;Tetrahydrofuran Series;Synthetic Organic Chemistry;7331-52-4 |
| Mol File: | 7331-52-4.mol |
 |
|
| (S)-3-Hydroxy-gamma-butyrolactone Chemical Properties |
| Boiling point | 98-100 °C0.3 mm Hg(lit.) |
| density | 1.241 g/mL at 25 °C(lit.) |
| refractive index | n20/D 1.464(lit.) |
| Fp | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| pka | 12.87±0.20(Predicted) |
| optical activity | [α]21/D 81°, c = 2 in ethanol |
| Water Solubility | Miscible with water, alcohol and other organic solvent. Immiscible with light petroleum. |
| BRN | 1280864 |
| InChI | InChI=1S/C4H6O3/c5-3-1-4(6)7-2-3/h3,5H,1-2H2/t3-/m0/s1 |
| InChIKey | FUDDLSHBRSNCBV-VKHMYHEASA-N |
| SMILES | O1C[C@@H](O)CC1=O |
| CAS DataBase Reference | 7331-52-4(CAS DataBase Reference) |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T，USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.
China
