
| CAS: | 737789-87-6 |
| MF: | C29H27F2N7O5S |
| MW: | 623.63 |
| EINECS: | 237-099-7 |
| Product Categories: | API;737789-87-6 |
| Mol File: | 737789-87-6.mol |
 |
|
| Relugolix Chemical Properties |
| Melting point | 228 °C (decomp)(Solv: ethyl acetate (141-78-6); tetrahydrofuran (109-99-9)) |
| density | 1.442±0.06 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| solubility | DMSO:20.0(Max Conc. mg/mL);32.1(Max Conc. mM) Ethanol:1.0(Max Conc. mg/mL);1.6(Max Conc. mM) |
| form | A crystalline solid |
| pka | 13.17±0.70(Predicted) |
| InChIKey | AOMXMOCNKJTRQP-UHFFFAOYSA-N |
| SMILES | N(C1=CC=C(C2SC3=C(C=2CN(C)C)C(=O)N(C2=NN=C(OC)C=C2)C(=O)N3CC2=C(F)C=CC=C2F)C=C1)C(NOC)=O |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T,USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.