| CAS: | 157115-85-0 |
| MF: | C17H22N2O4 |
| MW: | 318.37 |
| EINECS: | 1592732-453-0 |
| Product Categories: | pharmaceutical intermediate and medicine grade;API;157115-85-0 |
| Mol File: | 157115-85-0.mol |
 |
|
| Noopept Chemical Properties |
| Melting point | 94.0 to 98.0 °C |
| Boiling point | 547.3±50.0 °C(Predicted) |
| density | 1.202±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | Soluble in DMSO (up to 25 mg/ml) |
| pka | 13.41±0.20(Predicted) |
| form | powder |
| color | white to beige |
| optical activity | [α]/D -115 to -125°, c = 0.5 in chloroform-d |
| Stability: | Stable for 1 year from date of purchase as supplied. Solutions in DMSO may be stored at -20°C for up to 2 months. |
| InChI | InChI=1S/C17H22N2O4/c1-2-23-16(21)12-18-17(22)14-9-6-10-19(14)15(20)11-13-7-4-3-5-8-13/h3-5,7-8,14H,2,6,9-12H2,1H3,(H,18,22)/t14-/m0/s1 |
| InChIKey | PJNSMUBMSNAEEN-AWEZNQCLSA-N |
| SMILES | C(OCC)(=O)CNC(=O)[C@@H]1CCCN1C(CC1=CC=CC=C1)=O |
| CAS DataBase Reference | 157115-85-0 |
| RTECS | MC0814400 |
| HS Code | 29339900 |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T，USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.
China
