| CAS: | 121-97-1 |
| MF: | C10H12O2 |
| MW: | 164.2 |
| EINECS: | 204-512-7 |
| Product Categories: | Chemical Synthesis;Organic Building Blocks;Aromatic Propiophenones (substituted);Aromatics;Building Blocks;Carbonyl Compounds;Benzene series;Miscellaneous;C10;Carbonyl Compounds;Ketones;121-97-1 |
| Mol File: | 121-97-1.mol |
 |
|
| Methoxypropiophenone Chemical Properties |
| Melting point | 27-29 °C(lit.) |
| Boiling point | 273-275 °C(lit.) |
| density | 0.937 g/mL at 25 °C(lit.) |
| refractive index | n20/D 1.5465(lit.) |
| Fp | 142 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Liquid |
| Specific Gravity | 0.937 |
| color | Clear colorless to amber |
| Odor | at 1.00 % in dipropylene glycol. musty anisic |
| Odor Type | musty |
| BRN | 907733 |
| InChI | InChI=1S/C10H12O2/c1-3-10(11)8-4-6-9(12-2)7-5-8/h4-7H,3H2,1-2H3 |
| InChIKey | ZJVAWPKTWVFKHG-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(OC)C=C1)(=O)CC |
| LogP | 2.359 (est) |
| CAS DataBase Reference | 121-97-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Propanone, 1-(4-methoxyphenyl)-(121-97-1) |
| EPA Substance Registry System | 1-Propanone, 1-(4-methoxyphenyl)- (121-97-1) |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T，USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.
China
