
| CAS: | 942-92-7 |
| MF: | C12H16O |
| MW: | 176.25 |
| EINECS: | 213-394-6 |
| Product Categories: | C11 to C12;Carbonyl Compounds;Building Blocks;Chemical Synthesis;Ketones;Organic Building Blocks;942-92-7 |
| Mol File: | 942-92-7.mol |
 |
|
| Hexanophenone Chemical Properties |
| Melting point | 25-26 °C (lit.) |
| Boiling point | 265 °C (lit.) |
| density | 0.958 g/mL at 25 °C (lit.) |
| refractive index | n20/D 1.5105(lit.) |
| Fp | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Liquid After Melting |
| color | Clear light yellow |
| BRN | 1908667 |
| InChI | InChI=1S/C12H16O/c1-2-3-5-10-12(13)11-8-6-4-7-9-11/h4,6-9H,2-3,5,10H2,1H3 |
| InChIKey | MAHPVQDVMLWUAG-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC=C1)(=O)CCCCC |
| LogP | 3.790 (est) |
| CAS DataBase Reference | 942-92-7(CAS DataBase Reference) |
| EPA Substance Registry System | Hexanophenone (942-92-7) |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T,USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.