CAS: | 54123-15-8 |
MF: | C15H10ClFN4S |
MW: | 332.78 |
EINECS: | 200-284-8 |
Product Categories: |
|
Mol File: | 54123-15-8.mol |
|
|
Fluclotizolam Chemical Properties |
Boiling point | 524.0±60.0 °C(Predicted) |
density | 1.57±0.1 g/cm3(Predicted) |
storage temp. | -20°C |
solubility | DMF: 5 mg/ml DMSO: 5 mg/ml DMSO:PBS (pH 7.2) (1:1): 0.5 mg/ml |
pka | 2.01±0.40(Predicted) |
form | A crystalline solid |
λmax | 241 nm |
InChI | InChI=1S/C15H10ClFN4S/c1-8-19-20-13-7-18-14(9-4-2-3-5-11(9)17)10-6-12(16)22-15(10)21(8)13/h2-6H,7H2,1H3 |
InChIKey | ZDYRCUZZLRLMHG-UHFFFAOYSA-N |
SMILES | N12C(C)=NN=C1CN=C(C1=CC=CC=C1F)C1C=C(Cl)SC=12 |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T,USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.