| Epitalon Basic information |
| Product Name: | Epitalon |
| Synonyms: | Epitalon;Epithalon;Glycine, L-alanyl-L-a-glutamyl-L-a-aspartyl-;L-alanyl-L-alpha-glutamyl-L-alpha-aspartylglycine;9: PN: WO02090380 PAGE: 55 claimed protein;L-Alanyl-L-α-glutamyl-L-α-aspartylglycine;Epithalon, Epithalon Tetra Peptide;EpithalonAcetate |
| CAS: | 307297-39-8 |
| MF: | C14H22N4O9 |
| MW: | 390.35 |
| EINECS: | 211-519-9 |
| Product Categories: | 307297-39-8 |
| Mol File: | 307297-39-8.mol |
 |
|
| Epitalon Chemical Properties |
| Boiling point | 959.8±65.0 °C(Predicted) |
| density | 1.466±0.06 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| solubility | DMSO: 250 mg/mL (495.67 mM) |
| pka | 3.16±0.10(Predicted) |
| InChIKey | HGHOBRRUMWJWCU-VTCOHLDGNA-N |
| SMILES | [C@H](CC(=O)O)(C(=O)NCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](N)C |&1:0,15,24,r| |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T，USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.
China
