1. Product information
| Product Name: | Benzyl butyl phthalate |
| Synonyms: | SANTICIZER(R) 160;PHTHALIC ACID, BENZYLBUTYL ESTER;butyl phenylmethyl 1,2-benzenecarboxylate;Benzyl butyl phthalate,100 μL/mL in MeOH;Paratinol BB;C6H4(COOCH2C6H5)COO(CH2)3CH3;1-O-butyl 2-O-(phenylmethyl) benzene-1,2-dicarboxylate;benzene-1,2-dicarboxylic acid O2-(benzyl) ester O1-butyl ester |
| CAS: | 85-68-7 |
| MF: | C19H20O4 |
| MW: | 312.36 |
| EINECS: | 201-622-7 |
| Product Categories: | Aromatics, Metabolites & Impurities;Aromatics;Industrial/Fine Chemicals;BA - BHMethod Specific;Endocrine Disruptors (Draft)Cosmetics;Metabolites & Impurities;2000/60/ECMore...Close...;A-BAlphabetic;Allergens;Alpha Sort;B;EPA;European Community: ISO and DIN;Oeko-Tex Standard 100;Phthalates;Phthalates (Environmental Endocrine Disruptors);Analytical Chemistry;Environmental Endocrine Disruptors;Functional Materials;Phthalates (Plasticizer);Plasticizer;PhthalatesMethod Specific;Plasticizers (phthalates)Method Specific;Volatiles/ Semivolatiles;Plasticizers;Polymer Additives;Polymer Science;bc0001;85-68-7 |
| Mol File: | 85-68-7.mol |
 |
|
| Benzyl butyl phthalate Chemical Properties |
| Melting point | <-35°C |
| Boiling point | 370°C |
| density | 1.1 g/mL at 25 °C(lit.) |
| vapor density | 10.8 (vs air) |
| vapor pressure | 0.16 mm Hg ( 150 °C) |
| refractive index | n20/D 1.54(lit.) |
| Fp | >230 °F |
| storage temp. | room temp |
| solubility | DMSO: 100 mg/mL (320.14 mM) |
| form | Oily Liquid |
| Specific Gravity | 1.1 |
| color | Clear |
| Water Solubility | 0.000269 g/100 mL |
| FreezingPoint | -35℃ |
2. Packaging
For powders: normal is 25kgs/Drum or bag, or larger/smaller package as request.
For liquids: normal 25kgs/drum, 180-300kgs/bucket, or IBC, determined by the nature of the product.
Or smaller package 1kg/bottle, 10kgs/bottle as request.
3. Shipping
4. Contact information
For more details, pls contact us freely.
Email address : elin@fdachem.com
Mob: 86 13613820652
WhatsApp/Skype/Wechat/LINE: 86 13613820652
China
