1. Product information
| 9H-Carbazole, 2,7-bis(1,1-dimethylethyl)- Basic information |
| Product Name: | 9H-Carbazole, 2,7-bis(1,1-dimethylethyl)- |
| Synonyms: | 9H-Carbazole, 2,7-bis(1,1-dimethylethyl)-;2,7-di-tert-butylcarbazole;2,7-Bis(1,1-dimethylethyl)-9H-carbazole |
| CAS: | 69386-35-2 |
| MF: | C20H25N |
| MW: | 279.42 |
| EINECS: |
|
| Product Categories: |
|
| Mol File: | 69386-35-2.mol |
 |
|
| 9H-Carbazole, 2,7-bis(1,1-dimethylethyl)- Chemical Properties |
| Melting point | 155-156 °C(Solv: hexane (110-54-3)) |
| Boiling point | 424.2±14.0 °C(Predicted) |
| density | 1.037±0.06 g/cm3(Predicted) |
| pka | 17.55±0.30(Predicted) |
| InChI | InChI=1S/C20H25N/c1-19(2,3)13-7-9-15-16-10-8-14(20(4,5)6)12-18(16)21-17(15)11-13/h7-12,21H,1-6H3 |
| InChIKey | YAWXNJICXSLGGQ-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC(C(C)(C)C)=C2)C2=C1C=C(C(C)(C)C)C=C2 |
Specification
Items | Specifications | Test Result |
Appearance | Light yellow powder | Light yellow powder |
Assay | ≥98.0% | 99.9% |
2. Packaging
For powders: normal is 25kgs/Drum or bag, or larger/smaller package as request.
For liquids: normal 25kgs/drum, 180-300kgs/bucket, or IBC, determined by the nature of the product. Or smaller package 1kg/bottle, 10kgs/bottle as request.
3. Shipping
4. Contact information
For more details, pls contact us freely.
Email address : elin@fdachem.com
Mob: 86 13613820652
WhatsApp/Skype/Wechat/LINE: 86 13613820652
China
