
| CAS: | 1449-61-2 |
| MF: | C21H28O4 |
| MW: | 344.44 |
| EINECS: | 683-490-4 |
| Product Categories: | Pharmaceutical Raw Materials;steroids |
| Mol File: | 1449-61-2.mol |
 |
|
| Androst-5-en-3-ol-7,17-dione acetate Chemical Properties |
| Melting point | 184.5-187.5 °C |
| Boiling point | 479.6±45.0 °C(Predicted) |
| density | 1.17±0.1 g/cm3(Predicted) |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1/C21H28O4/c1-12(22)25-14-6-8-20(2)13(10-14)11-17(23)19-15-4-5-18(24)21(15,3)9-7-16(19)20/h11,14-16,19H,4-10H2,1-3H3/t14-,15-,16-,19-,20-,21-/s3 |
| InChIKey | VVSMJVQHDZUPIL-XHRCOXFGNA-N |
| SMILES | [C@@]12([H])C(=O)C=C3C[C@@H](OC(=O)C)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)C(CC[C@@]21[H])=O |&1:0,7,14,16,20,25,r| |
| CAS DataBase Reference | 1449-61-2(CAS DataBase Reference) |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T,USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.