1. Product information
| Product Name: | 6-BROMONAPHTHALEN-2-AMINE |
| Synonyms: | 6-Bromo-2-naphthylamine, 6-Bromonaphthalen-2-amine;6-BroMo-2-naphthalenaMine;NSC 407685;6-broMo-2-aMinonaphthalene;2-Amino-6-bromophthalene;2-Amino-6-bromonaphthalene;6-Bromonaphthalen-2-ylamine;2-Naphthalenamine, 6-bromo- |
| CAS: | 7499-66-3 |
| MF: | C10H8BrN |
| MW: | 222.08 |
| EINECS: | 1308068-626-2 |
| Product Categories: | Aromatics;Amines;7499-66-3 |
| Mol File: | 7499-66-3.mol |
 |
|
| 6-BROMONAPHTHALEN-2-AMINE Chemical Properties |
| Melting point | 128 °C |
| Boiling point | 155-160 °C(Press: 1 Torr) |
| density | 1.563±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | solid |
| pka | 3.66±0.10(Predicted) |
| color | grey |
| InChI | InChI=1S/C10H8BrN/c11-9-3-1-8-6-10(12)4-2-7(8)5-9/h1-6H,12H2 |
| InChIKey | UBLKHAWYJFEPDX-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=C(Br)C=C2)=CC=C1N |
| Hazard Note | Irritant |
| HS Code | 2921450090 |
|
| 6-BROMONAPHTHALEN-2-AMINE Usage And Synthesis |
| Uses | 6-Bromonaphthalen-2-amine is used in the new synthesis of alkylsulphanylnaphthalenes and the synthesis and mesomorphic properties of novel naphthylisothiocyanates. |
2. Packaging
For powders: normal is 25kgs/Drum or bag, or larger/smaller package as request.
For liquids: normal 25kgs/drum, 180-300kgs/bucket, or IBC, determined by the nature of the product.
Or smaller package 1kg/bottle, 10kgs/bottle as request.
3. Shipping
4. Contact information
For more details, pls contact us freely.
Email address : elin@fdachem.com
Mob: 86 13613820652
WhatsApp/Skype/Wechat/LINE: 86 13613820652
China
