| Product Name: |
7-bromo-3,4-dihydronaphthalen-1(2H)-one
|
| Synonyms: |
7-bromo-3,4-dihydronaphthalen-1(2H)-one; 7-bromo-3,4-dihydro-1(2H)-naphthalenone;7-Bromo-1-tetralone
|
| CAS RN.: |
32281-97-3
|
| InChI: |
InChI=1/C10H9BrO/c11-8-5-4-7-2-1-3-10(12)9(7)6-8/h4-6H,1-3H2 |
| Molecular Weight: |
225.0819 |
| Molecular Formula: |
C10H9BrO |
| Density: |
1.511g/cm3 |
| Boiling Point(℃): |
311.9°C at 760 mmHg |
| Flash Point(℃): |
103.5°C |
| refractive_index: |
1.598 |
| Vapour pressure: |
0.000548mmHg at 25°C |
Apperance: white powder
Stoage:in shade
Means of Transportation: By air(EMS or EUB or FedEx or TNT ect...) or by sea(FOB or CIF or CNF ect...)
Usage : chemical research
| Product Name: |
7-bromo-3,4-dihydronaphthalen-1(2H)-one
|
| Synonyms: |
7-bromo-3,4-dihydronaphthalen-1(2H)-one; 7-bromo-3,4-dihydro-1(2H)-naphthalenone;7-Bromo-1-tetralone
|
| CAS RN.: |
32281-97-3
|
| InChI: |
InChI=1/C10H9BrO/c11-8-5-4-7-2-1-3-10(12)9(7)6-8/h4-6H,1-3H2 |
| Molecular Weight: |
225.0819 |
| Molecular Formula: |
C10H9BrO |
| Density: |
1.511g/cm3 |
| Boiling Point(℃): |
311.9°C at 760 mmHg |
| Flash Point(℃): |
103.5°C |
| refractive_index: |
1.598 |
| Vapour pressure: |
0.000548mmHg at 25°C |
Apperance: white powder
Stoage:in shade
Means of Transportation: By air(EMS or EUB or FedEx or TNT ect...) or by sea(FOB or CIF or CNF ect...)
Usage : chemical research






The images only for reference